ChemNet > CAS > 4923-87-9;133150-64-8 5-Bromobenzo[b]thiophene
4923-87-9;133150-64-8 5-Bromobenzo[b]thiophene
نام محصول |
5-Bromobenzo[b]thiophene |
مترادف |
5-Bromothianaphthene; 5-bromo-1-benzothiophene; 5-Bromobenzo[b]thioophene; 5-Bromobenzothiophene; ; BUTTPARK 98\04-80; Benzo[c]thiophene, 5-bromo- |
میدان مغناطیسی |
C8H5BrS |
وزن مولکولی |
213.0943 |
InChI |
InChI=1/C8H5BrS/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5H |
شماره سیایاس |
4923-87-9;133150-64-8 |
ساختار مولکولی |
|
تراکم |
1.649g/cm3 |
نقطه ذوب |
46℃ |
نقطه غلیان |
284.7°C at 760 mmHg |
ضریب شکست |
1.704 |
نقطه اشتعال |
126°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|